C13H9FN4O2S — CID 106698646
2-fluoro-4-(7H-purin-6-ylsulfanylmethyl)benzoic acid (PubChem CID 106698646) has the molecular formula C13H9FN4O2S and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-fluoro-4-(7H-purin-6-ylsulfanylmethyl)benzoic acid.
| Compound Name | 2-fluoro-4-(7H-purin-6-ylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 106698646 |
| Molecular Formula | C13H9FN4O2S |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-fluoro-4-(7H-purin-6-ylsulfanylmethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CSc2ncnc3nc[nH]c23)cc1F |
| InChI | InChI=1S/C13H9FN4O2S/c14-9-3-7(1-2-8(9)13(19)20)4-21-12-10-11(16-5-15-10)17-6-18-12/h1-3,5-6H,4H2,(H,19,20)(H,15,16,17,18) |
| InChIKey | GFLDKDXNHLINHV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |