C19H13FN6O3S — CID 3600787
4-[[6-[(4-fluorophenyl)methylsulfanyl]-7H-purin-8-yl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 3600787) has the molecular formula C19H13FN6O3S and a molecular weight of 424.42 g/mol. Its IUPAC name is 4-[[6-[(4-fluorophenyl)methylsulfanyl]-7H-purin-8-yl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 4-[[6-[(4-fluorophenyl)methylsulfanyl]-7H-purin-8-yl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 3600787 |
| Molecular Formula | C19H13FN6O3S |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 4-[[6-[(4-fluorophenyl)methylsulfanyl]-7H-purin-8-yl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(/N=N/c2nc3ncnc(SCc4ccc(F)cc4)c3[nH]2)cc1O |
| InChI | InChI=1S/C19H13FN6O3S/c20-11-3-1-10(2-4-11)8-30-17-15-16(21-9-22-17)24-19(23-15)26-25-12-5-6-13(18(28)29)14(27)7-12/h1-7,9,27H,8H2,(H,28,29)(H,21,22,23,24)/b26-25+ |
| InChIKey | OZCRDWVPUANKSX-OCEACIFDSA-N |
| XLogP | 4.60 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|