C15H9N7OS — CID 167779291
3-[5-(7H-purin-6-ylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzonitrile (PubChem CID 167779291) has the molecular formula C15H9N7OS and a molecular weight of 335.35 g/mol. Its IUPAC name is 3-[5-(7H-purin-6-ylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzonitrile.
| Compound Name | 3-[5-(7H-purin-6-ylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 167779291 |
| Molecular Formula | C15H9N7OS |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 3-[5-(7H-purin-6-ylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2nnc(CSc3ncnc4nc[nH]c34)o2)c1 |
| InChI | InChI=1S/C15H9N7OS/c16-5-9-2-1-3-10(4-9)14-22-21-11(23-14)6-24-15-12-13(18-7-17-12)19-8-20-15/h1-4,7-8H,6H2,(H,17,18,19,20) |
| InChIKey | JGKORRYRERERBW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |