C21H15ClN6OS — CID 126599582
3-(2-chlorophenyl)-5-methyl-2-(7H-purin-8-ylsulfanylmethyl)quinazolin-4-one (PubChem CID 126599582) has the molecular formula C21H15ClN6OS and a molecular weight of 434.91 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-methyl-2-(7H-purin-8-ylsulfanylmethyl)quinazolin-4-one.
| Compound Name | 3-(2-chlorophenyl)-5-methyl-2-(7H-purin-8-ylsulfanylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126599582 |
| Molecular Formula | C21H15ClN6OS |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 3-(2-chlorophenyl)-5-methyl-2-(7H-purin-8-ylsulfanylmethyl)quinazolin-4-one |
| SMILES | Cc1cccc2nc(CSc3nc4ncncc4[nH]3)n(-c3ccccc3Cl)c(=O)c12 |
| InChI | InChI=1S/C21H15ClN6OS/c1-12-5-4-7-14-18(12)20(29)28(16-8-3-2-6-13(16)22)17(25-14)10-30-21-26-15-9-23-11-24-19(15)27-21/h2-9,11H,10H2,1H3,(H,23,24,26,27) |
| InChIKey | NCMFYVIGQOVOJA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |