C15H14N6S — CID 86814384
6-[2-(2-methylbenzimidazol-1-yl)ethylsulfanyl]-7H-purine (PubChem CID 86814384) has the molecular formula C15H14N6S and a molecular weight of 310.39 g/mol. Its IUPAC name is 6-[2-(2-methylbenzimidazol-1-yl)ethylsulfanyl]-7H-purine.
| Compound Name | 6-[2-(2-methylbenzimidazol-1-yl)ethylsulfanyl]-7H-purine |
|---|---|
| PubChem CID | 86814384 |
| Molecular Formula | C15H14N6S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 6-[2-(2-methylbenzimidazol-1-yl)ethylsulfanyl]-7H-purine |
| SMILES | Cc1nc2ccccc2n1CCSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C15H14N6S/c1-10-20-11-4-2-3-5-12(11)21(10)6-7-22-15-13-14(17-8-16-13)18-9-19-15/h2-5,8-9H,6-7H2,1H3,(H,16,17,18,19) |
| InChIKey | ZXHXXZAHYYTNTK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |