C24H33N5O2S — CID 18998456
phenyl N-heptyl-N-[5-(7H-purin-6-ylsulfanyl)pentyl]carbamate (PubChem CID 18998456) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is phenyl N-heptyl-N-[5-(7H-purin-6-ylsulfanyl)pentyl]carbamate.
| Compound Name | phenyl N-heptyl-N-[5-(7H-purin-6-ylsulfanyl)pentyl]carbamate |
|---|---|
| PubChem CID | 18998456 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | phenyl N-heptyl-N-[5-(7H-purin-6-ylsulfanyl)pentyl]carbamate |
| SMILES | CCCCCCCN(CCCCCSc1ncnc2nc[nH]c12)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C24H33N5O2S/c1-2-3-4-5-10-15-29(24(30)31-20-13-8-6-9-14-20)16-11-7-12-17-32-23-21-22(26-18-25-21)27-19-28-23/h6,8-9,13-14,18-19H,2-5,7,10-12,15-17H2,1H3,(H,25,26,27,28) |
| InChIKey | QPKBASVEMSRJDW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|