C18H25N5O5S — CID 101132373
diethyl (2S)-2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]butanedioate (PubChem CID 101132373) has the molecular formula C18H25N5O5S and a molecular weight of 423.50 g/mol. Its IUPAC name is diethyl (2S)-2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]butanedioate.
| Compound Name | diethyl (2S)-2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]butanedioate |
|---|---|
| PubChem CID | 101132373 |
| Molecular Formula | C18H25N5O5S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | diethyl (2S)-2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]butanedioate |
| SMILES | CCOC(=O)C[C@H](NC(=O)CCCCSc1ncnc2nc[nH]c12)C(=O)OCC |
| InChI | InChI=1S/C18H25N5O5S/c1-3-27-14(25)9-12(18(26)28-4-2)23-13(24)7-5-6-8-29-17-15-16(20-10-19-15)21-11-22-17/h10-12H,3-9H2,1-2H3,(H,23,24)(H,19,20,21,22)/t12-/m0/s1 |
| InChIKey | GGSUQHIIPQXYRV-LBPRGKRZSA-N |
| XLogP | 1.62 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|