C22H33N7O5S — CID 102019175
ethyl (2S)-4-methyl-2-[[2-[[2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]acetyl]amino]acetyl]amino]pentanoate (PubChem CID 102019175) has the molecular formula C22H33N7O5S and a molecular weight of 507.62 g/mol. Its IUPAC name is ethyl (2S)-4-methyl-2-[[2-[[2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]acetyl]amino]acetyl]amino]pentanoate.
| Compound Name | ethyl (2S)-4-methyl-2-[[2-[[2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]acetyl]amino]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 102019175 |
| Molecular Formula | C22H33N7O5S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | ethyl (2S)-4-methyl-2-[[2-[[2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]acetyl]amino]acetyl]amino]pentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)CNC(=O)CCCCSc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C22H33N7O5S/c1-4-34-22(33)15(9-14(2)3)29-18(32)11-24-17(31)10-23-16(30)7-5-6-8-35-21-19-20(26-12-25-19)27-13-28-21/h12-15H,4-11H2,1-3H3,(H,23,30)(H,24,31)(H,29,32)(H,25,26,27,28)/t15-/m0/s1 |
| InChIKey | STQHTUZZYVIRNG-HNNXBMFYSA-N |
| XLogP | 0.94 |
| TPSA | 168.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|