C8H9N4Y- — CID 176927745
6-propan-2-yl-2,7-dihydropurin-2-ide;yttrium (PubChem CID 176927745) has the molecular formula C8H9N4Y- and a molecular weight of 250.09 g/mol. Its IUPAC name is 6-propan-2-yl-2,7-dihydropurin-2-ide;yttrium.
| Compound Name | 6-propan-2-yl-2,7-dihydropurin-2-ide;yttrium |
|---|---|
| PubChem CID | 176927745 |
| Molecular Formula | C8H9N4Y- |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 6-propan-2-yl-2,7-dihydropurin-2-ide;yttrium |
| SMILES | CC(C)c1n[c-]nc2nc[nH]c12.[Y] |
| InChI | InChI=1S/C8H9N4.Y/c1-5(2)6-7-8(11-3-9-6)12-4-10-7;/h4-5H,1-2H3,(H,9,10,11,12);/q-1; |
| InChIKey | FLIULIYTNVIVQU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|