C12H14N6O — CID 66022951
5-tert-butyl-2-(7H-purin-6-yl)-1H-pyrazol-3-one (PubChem CID 66022951) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-tert-butyl-2-(7H-purin-6-yl)-1H-pyrazol-3-one.
| Compound Name | 5-tert-butyl-2-(7H-purin-6-yl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 66022951 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-tert-butyl-2-(7H-purin-6-yl)-1H-pyrazol-3-one |
| SMILES | CC(C)(C)c1cc(=O)n(-c2ncnc3nc[nH]c23)[nH]1 |
| InChI | InChI=1S/C12H14N6O/c1-12(2,3)7-4-8(19)18(17-7)11-9-10(14-5-13-9)15-6-16-11/h4-6,17H,1-3H3,(H,13,14,15,16) |
| InChIKey | PHBIJAPEPYRHND-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |