C10H11N7O — CID 103995179
4-amino-5-ethyl-2-(7H-purin-6-yl)-1H-pyrazol-3-one (PubChem CID 103995179) has the molecular formula C10H11N7O and a molecular weight of 245.25 g/mol. Its IUPAC name is 4-amino-5-ethyl-2-(7H-purin-6-yl)-1H-pyrazol-3-one.
| Compound Name | 4-amino-5-ethyl-2-(7H-purin-6-yl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 103995179 |
| Molecular Formula | C10H11N7O |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-amino-5-ethyl-2-(7H-purin-6-yl)-1H-pyrazol-3-one |
| SMILES | CCc1[nH]n(-c2ncnc3nc[nH]c23)c(=O)c1N |
| InChI | InChI=1S/C10H11N7O/c1-2-5-6(11)10(18)17(16-5)9-7-8(13-3-12-7)14-4-15-9/h3-4,16H,2,11H2,1H3,(H,12,13,14,15) |
| InChIKey | ISVUJEZKDFLMDH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |