C10H11N7O2 — CID 103995180
4-amino-5-(methoxymethyl)-2-(7H-purin-6-yl)-1H-pyrazol-3-one (PubChem CID 103995180) has the molecular formula C10H11N7O2 and a molecular weight of 261.25 g/mol. Its IUPAC name is 4-amino-5-(methoxymethyl)-2-(7H-purin-6-yl)-1H-pyrazol-3-one.
| Compound Name | 4-amino-5-(methoxymethyl)-2-(7H-purin-6-yl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 103995180 |
| Molecular Formula | C10H11N7O2 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-amino-5-(methoxymethyl)-2-(7H-purin-6-yl)-1H-pyrazol-3-one |
| SMILES | COCc1[nH]n(-c2ncnc3nc[nH]c23)c(=O)c1N |
| InChI | InChI=1S/C10H11N7O2/c1-19-2-5-6(11)10(18)17(16-5)9-7-8(13-3-12-7)14-4-15-9/h3-4,16H,2,11H2,1H3,(H,12,13,14,15) |
| InChIKey | SBCIEDIEUZEHIQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |