C14H10N6 — CID 66013947
6-(3-phenylpyrazol-1-yl)-7H-purine (PubChem CID 66013947) has the molecular formula C14H10N6 and a molecular weight of 262.28 g/mol. Its IUPAC name is 6-(3-phenylpyrazol-1-yl)-7H-purine.
| Compound Name | 6-(3-phenylpyrazol-1-yl)-7H-purine |
|---|---|
| PubChem CID | 66013947 |
| Molecular Formula | C14H10N6 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 6-(3-phenylpyrazol-1-yl)-7H-purine |
| SMILES | c1ccc(-c2ccn(-c3ncnc4nc[nH]c34)n2)cc1 |
| InChI | InChI=1S/C14H10N6/c1-2-4-10(5-3-1)11-6-7-20(19-11)14-12-13(16-8-15-12)17-9-18-14/h1-9H,(H,15,16,17,18) |
| InChIKey | LEQNIGAJYSEEDM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |