C12H13N7S — CID 114788402
6-(4,5,6-trimethylpyrimidin-2-yl)sulfanyl-7H-purin-2-amine (PubChem CID 114788402) has the molecular formula C12H13N7S and a molecular weight of 287.35 g/mol. Its IUPAC name is 6-(4,5,6-trimethylpyrimidin-2-yl)sulfanyl-7H-purin-2-amine.
| Compound Name | 6-(4,5,6-trimethylpyrimidin-2-yl)sulfanyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114788402 |
| Molecular Formula | C12H13N7S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 6-(4,5,6-trimethylpyrimidin-2-yl)sulfanyl-7H-purin-2-amine |
| SMILES | Cc1nc(Sc2nc(N)nc3nc[nH]c23)nc(C)c1C |
| InChI | InChI=1S/C12H13N7S/c1-5-6(2)16-12(17-7(5)3)20-10-8-9(15-4-14-8)18-11(13)19-10/h4H,1-3H3,(H3,13,14,15,18,19) |
| InChIKey | VISGQZVCDZTGCL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |