C9H8N8OS — CID 136981709
4-amino-2-[(2-amino-7H-purin-6-yl)sulfanyl]-1H-pyrimidin-6-one (PubChem CID 136981709) has the molecular formula C9H8N8OS and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-amino-2-[(2-amino-7H-purin-6-yl)sulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(2-amino-7H-purin-6-yl)sulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136981709 |
| Molecular Formula | C9H8N8OS |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 4-amino-2-[(2-amino-7H-purin-6-yl)sulfanyl]-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(Sc2nc(N)nc3nc[nH]c23)n1 |
| InChI | InChI=1S/C9H8N8OS/c10-3-1-4(18)15-9(14-3)19-7-5-6(13-2-12-5)16-8(11)17-7/h1-2H,(H3,10,14,15,18)(H3,11,12,13,16,17) |
| InChIKey | DQKMNJQULPCBDU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 152.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |