C8H9N7S — CID 4040642
6-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-7H-purin-2-amine (PubChem CID 4040642) has the molecular formula C8H9N7S and a molecular weight of 235.28 g/mol. Its IUPAC name is 6-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-7H-purin-2-amine.
| Compound Name | 6-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 4040642 |
| Molecular Formula | C8H9N7S |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 6-(4,5-dihydro-1H-imidazol-2-ylsulfanyl)-7H-purin-2-amine |
| SMILES | Nc1nc(SC2=NCCN2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C8H9N7S/c9-7-14-5-4(12-3-13-5)6(15-7)16-8-10-1-2-11-8/h3H,1-2H2,(H,10,11)(H3,9,12,13,14,15) |
| InChIKey | SCJUKCMZUDPUPV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |