C10H7N7 — CID 114052461
1-(2-amino-7H-purin-6-yl)pyrrole-2-carbonitrile (PubChem CID 114052461) has the molecular formula C10H7N7 and a molecular weight of 225.22 g/mol. Its IUPAC name is 1-(2-amino-7H-purin-6-yl)pyrrole-2-carbonitrile.
| Compound Name | 1-(2-amino-7H-purin-6-yl)pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 114052461 |
| Molecular Formula | C10H7N7 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-(2-amino-7H-purin-6-yl)pyrrole-2-carbonitrile |
| SMILES | N#Cc1cccn1-c1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H7N7/c11-4-6-2-1-3-17(6)9-7-8(14-5-13-7)15-10(12)16-9/h1-3,5H,(H3,12,13,14,15,16) |
| InChIKey | MYUSUUIMYZTBOF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |