C12H8FN7 — CID 114783970
2-[(2-amino-7H-purin-6-yl)amino]-6-fluorobenzonitrile (PubChem CID 114783970) has the molecular formula C12H8FN7 and a molecular weight of 269.24 g/mol. Its IUPAC name is 2-[(2-amino-7H-purin-6-yl)amino]-6-fluorobenzonitrile.
| Compound Name | 2-[(2-amino-7H-purin-6-yl)amino]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 114783970 |
| Molecular Formula | C12H8FN7 |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-[(2-amino-7H-purin-6-yl)amino]-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)cccc1Nc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H8FN7/c13-7-2-1-3-8(6(7)4-14)18-11-9-10(17-5-16-9)19-12(15)20-11/h1-3,5H,(H4,15,16,17,18,19,20) |
| InChIKey | CQSWPHVBMBGKCS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |