C11H8BrClN6 — CID 114785747
6-N-(2-bromo-4-chlorophenyl)-7H-purine-2,6-diamine (PubChem CID 114785747) has the molecular formula C11H8BrClN6 and a molecular weight of 339.58 g/mol. Its IUPAC name is 6-N-(2-bromo-4-chlorophenyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(2-bromo-4-chlorophenyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785747 |
| Molecular Formula | C11H8BrClN6 |
| Molecular Weight | 339.58 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 6-N-(2-bromo-4-chlorophenyl)-7H-purine-2,6-diamine |
| SMILES | Nc1nc(Nc2ccc(Cl)cc2Br)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H8BrClN6/c12-6-3-5(13)1-2-7(6)17-10-8-9(16-4-15-8)18-11(14)19-10/h1-4H,(H4,14,15,16,17,18,19) |
| InChIKey | QEKWEKLBISLCHU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |