C12H11BrN6 — CID 114785187
6-N-(3-bromo-4-methylphenyl)-7H-purine-2,6-diamine (PubChem CID 114785187) has the molecular formula C12H11BrN6 and a molecular weight of 319.17 g/mol. Its IUPAC name is 6-N-(3-bromo-4-methylphenyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(3-bromo-4-methylphenyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785187 |
| Molecular Formula | C12H11BrN6 |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 6-N-(3-bromo-4-methylphenyl)-7H-purine-2,6-diamine |
| SMILES | Cc1ccc(Nc2nc(N)nc3nc[nH]c23)cc1Br |
| InChI | InChI=1S/C12H11BrN6/c1-6-2-3-7(4-8(6)13)17-11-9-10(16-5-15-9)18-12(14)19-11/h2-5H,1H3,(H4,14,15,16,17,18,19) |
| InChIKey | BDDCIXQZFSUQFG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |