C10H8F3N7 — CID 114786674
N-methyl-6-[3-(trifluoromethyl)pyrazol-1-yl]-7H-purin-2-amine (PubChem CID 114786674) has the molecular formula C10H8F3N7 and a molecular weight of 283.22 g/mol. Its IUPAC name is N-methyl-6-[3-(trifluoromethyl)pyrazol-1-yl]-7H-purin-2-amine.
| Compound Name | N-methyl-6-[3-(trifluoromethyl)pyrazol-1-yl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 114786674 |
| Molecular Formula | C10H8F3N7 |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-methyl-6-[3-(trifluoromethyl)pyrazol-1-yl]-7H-purin-2-amine |
| SMILES | CNc1nc(-n2ccc(C(F)(F)F)n2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H8F3N7/c1-14-9-17-7-6(15-4-16-7)8(18-9)20-3-2-5(19-20)10(11,12)13/h2-4H,1H3,(H2,14,15,16,17,18) |
| InChIKey | BNALYVWYJFVLAB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |