C7H12N2OS — CID 156733967
ethane;5-methyl-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 156733967) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is ethane;5-methyl-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | ethane;5-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 156733967 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | ethane;5-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | CC.Cc1c[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C5H6N2OS.C2H6/c1-3-2-6-5(9)7-4(3)8;1-2/h2H,1H3,(H2,6,7,8,9);1-2H3 |
| InChIKey | KPPYZNIRSFAXOW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|