C11H11N3OS — CID 121006196
5-(4-methylanilino)-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 121006196) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 5-(4-methylanilino)-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-(4-methylanilino)-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 121006196 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 5-(4-methylanilino)-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | Cc1ccc(Nc2c[nH]c(=S)[nH]c2=O)cc1 |
| InChI | InChI=1S/C11H11N3OS/c1-7-2-4-8(5-3-7)13-9-6-12-11(16)14-10(9)15/h2-6,13H,1H3,(H2,12,14,15,16) |
| InChIKey | DNUCMHOTOMEALM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|