C10H7Cl2N3O2 — CID 17275056
5-(3,4-dichloroanilino)-1H-pyrimidine-2,4-dione (PubChem CID 17275056) has the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.09 g/mol. Its IUPAC name is 5-(3,4-dichloroanilino)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(3,4-dichloroanilino)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 17275056 |
| Molecular Formula | C10H7Cl2N3O2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 5-(3,4-dichloroanilino)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(Nc2ccc(Cl)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H7Cl2N3O2/c11-6-2-1-5(3-7(6)12)14-8-4-13-10(17)15-9(8)16/h1-4,14H,(H2,13,15,16,17) |
| InChIKey | FMZGDEZMHNVEGK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |