C9H8Cl2N4 — CID 114991830
4-N-(3,4-dichlorophenyl)-1H-pyrazole-4,5-diamine (PubChem CID 114991830) has the molecular formula C9H8Cl2N4 and a molecular weight of 243.10 g/mol. Its IUPAC name is 4-N-(3,4-dichlorophenyl)-1H-pyrazole-4,5-diamine.
| Compound Name | 4-N-(3,4-dichlorophenyl)-1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 114991830 |
| Molecular Formula | C9H8Cl2N4 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 4-N-(3,4-dichlorophenyl)-1H-pyrazole-4,5-diamine |
| SMILES | Nc1[nH]ncc1Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N4/c10-6-2-1-5(3-7(6)11)14-8-4-13-15-9(8)12/h1-4,14H,(H3,12,13,15) |
| InChIKey | SOIGMPGDVSNCRE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |