C9H9ClN4 — CID 57126804
4-N-(3-chlorophenyl)-1H-pyrazole-4,5-diamine (PubChem CID 57126804) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-1H-pyrazole-4,5-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 57126804 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 4-N-(3-chlorophenyl)-1H-pyrazole-4,5-diamine |
| SMILES | Nc1[nH]ncc1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H9ClN4/c10-6-2-1-3-7(4-6)13-8-5-12-14-9(8)11/h1-5,13H,(H3,11,12,14) |
| InChIKey | AOKPZEFVROUSHF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |