C15H12ClIN4 — CID 57295767
4-N-(3-chlorophenyl)-5-N-(4-iodophenyl)-1H-pyrazole-4,5-diamine (PubChem CID 57295767) has the molecular formula C15H12ClIN4 and a molecular weight of 410.65 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-5-N-(4-iodophenyl)-1H-pyrazole-4,5-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-5-N-(4-iodophenyl)-1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 57295767 |
| Molecular Formula | C15H12ClIN4 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 4-N-(3-chlorophenyl)-5-N-(4-iodophenyl)-1H-pyrazole-4,5-diamine |
| SMILES | Clc1cccc(Nc2cn[nH]c2Nc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C15H12ClIN4/c16-10-2-1-3-13(8-10)19-14-9-18-21-15(14)20-12-6-4-11(17)5-7-12/h1-9,19H,(H2,18,20,21) |
| InChIKey | YFRUVJSTBFHBOD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|