C17H15Cl2N7 — CID 19610615
3-N-(4-aminophenyl)-4-N-(3-chlorophenyl)-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine;hydrochloride (PubChem CID 19610615) has the molecular formula C17H15Cl2N7 and a molecular weight of 388.26 g/mol. Its IUPAC name is 3-N-(4-aminophenyl)-4-N-(3-chlorophenyl)-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine;hydrochloride.
| Compound Name | 3-N-(4-aminophenyl)-4-N-(3-chlorophenyl)-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 19610615 |
| Molecular Formula | C17H15Cl2N7 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 3-N-(4-aminophenyl)-4-N-(3-chlorophenyl)-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(Nc2[nH]nc3ncnc(Nc4cccc(Cl)c4)c23)cc1 |
| InChI | InChI=1S/C17H14ClN7.ClH/c18-10-2-1-3-13(8-10)23-15-14-16(21-9-20-15)24-25-17(14)22-12-6-4-11(19)5-7-12;/h1-9H,19H2,(H3,20,21,22,23,24,25);1H |
| InChIKey | RRWXNZYBSKSJGM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|