C19H16ClN7O2 — CID 19610633
N-[5-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]-2-methoxyphenyl]formamide (PubChem CID 19610633) has the molecular formula C19H16ClN7O2 and a molecular weight of 409.84 g/mol. Its IUPAC name is N-[5-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]-2-methoxyphenyl]formamide.
| Compound Name | N-[5-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]-2-methoxyphenyl]formamide |
|---|---|
| PubChem CID | 19610633 |
| Molecular Formula | C19H16ClN7O2 |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[5-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]-2-methoxyphenyl]formamide |
| SMILES | COc1ccc(Nc2[nH]nc3ncnc(Nc4cccc(Cl)c4)c23)cc1NC=O |
| InChI | InChI=1S/C19H16ClN7O2/c1-29-15-6-5-13(8-14(15)23-10-28)25-19-16-17(21-9-22-18(16)26-27-19)24-12-4-2-3-11(20)7-12/h2-10H,1H3,(H,23,28)(H3,21,22,24,25,26,27) |
| InChIKey | CCQNTEGCHUPYOL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|