C19H16ClN7O — CID 19610587
N-[[4-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]methyl]formamide (PubChem CID 19610587) has the molecular formula C19H16ClN7O and a molecular weight of 393.84 g/mol. Its IUPAC name is N-[[4-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]methyl]formamide.
| Compound Name | N-[[4-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 19610587 |
| Molecular Formula | C19H16ClN7O |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[[4-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]methyl]formamide |
| SMILES | O=CNCc1ccc(Nc2[nH]nc3ncnc(Nc4cccc(Cl)c4)c23)cc1 |
| InChI | InChI=1S/C19H16ClN7O/c20-13-2-1-3-15(8-13)25-17-16-18(23-10-22-17)26-27-19(16)24-14-6-4-12(5-7-14)9-21-11-28/h1-8,10-11H,9H2,(H,21,28)(H3,22,23,24,25,26,27) |
| InChIKey | UEAJMJCKBVXEJZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|