C15H16ClN7O — CID 21190591
N-[3-[[4-(3-chloroanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]amino]propyl]formamide (PubChem CID 21190591) has the molecular formula C15H16ClN7O and a molecular weight of 345.79 g/mol. Its IUPAC name is N-[3-[[4-(3-chloroanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]amino]propyl]formamide.
| Compound Name | N-[3-[[4-(3-chloroanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]amino]propyl]formamide |
|---|---|
| PubChem CID | 21190591 |
| Molecular Formula | C15H16ClN7O |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[3-[[4-(3-chloroanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]amino]propyl]formamide |
| SMILES | O=CNCCCNc1n[nH]c2ncnc(Nc3cccc(Cl)c3)c12 |
| InChI | InChI=1S/C15H16ClN7O/c16-10-3-1-4-11(7-10)21-13-12-14(18-6-2-5-17-9-24)22-23-15(12)20-8-19-13/h1,3-4,7-9H,2,5-6H2,(H,17,24)(H3,18,19,20,21,22,23) |
| InChIKey | ZVEZCNCIUJOJGE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|