C20H17ClN8O3 — CID 21190731
N-[2-[[4-(3-chloroanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]amino]ethyl]-4-nitrobenzamide (PubChem CID 21190731) has the molecular formula C20H17ClN8O3 and a molecular weight of 452.86 g/mol. Its IUPAC name is N-[2-[[4-(3-chloroanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]amino]ethyl]-4-nitrobenzamide.
| Compound Name | N-[2-[[4-(3-chloroanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]amino]ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 21190731 |
| Molecular Formula | C20H17ClN8O3 |
| Molecular Weight | 452.86 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[2-[[4-(3-chloroanilino)-1H-pyrazolo[5,4-d]pyrimidin-3-yl]amino]ethyl]-4-nitrobenzamide |
| SMILES | O=C(NCCNc1n[nH]c2ncnc(Nc3cccc(Cl)c3)c12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H17ClN8O3/c21-13-2-1-3-14(10-13)26-17-16-18(27-28-19(16)25-11-24-17)22-8-9-23-20(30)12-4-6-15(7-5-12)29(31)32/h1-7,10-11H,8-9H2,(H,23,30)(H3,22,24,25,26,27,28) |
| InChIKey | DYTZTVZLRYMPRP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 150.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.86 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|