C13H10BrClN4 — CID 23282803
6-(bromomethyl)-N-(3-chlorophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 23282803) has the molecular formula C13H10BrClN4 and a molecular weight of 337.61 g/mol. Its IUPAC name is 6-(bromomethyl)-N-(3-chlorophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(bromomethyl)-N-(3-chlorophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23282803 |
| Molecular Formula | C13H10BrClN4 |
| Molecular Weight | 337.61 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 6-(bromomethyl)-N-(3-chlorophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1cccc(Nc2ncnc3[nH]c(CBr)cc23)c1 |
| InChI | InChI=1S/C13H10BrClN4/c14-6-10-5-11-12(16-7-17-13(11)19-10)18-9-3-1-2-8(15)4-9/h1-5,7H,6H2,(H2,16,17,18,19) |
| InChIKey | RHWWAIDIUZKYKK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|