C26H23ClN8O2 — CID 87954501
N-[[4-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]-(3-methoxyanilino)methyl]formamide (PubChem CID 87954501) has the molecular formula C26H23ClN8O2 and a molecular weight of 514.98 g/mol. Its IUPAC name is N-[[4-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]-(3-methoxyanilino)methyl]formamide.
| Compound Name | N-[[4-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]-(3-methoxyanilino)methyl]formamide |
|---|---|
| PubChem CID | 87954501 |
| Molecular Formula | C26H23ClN8O2 |
| Molecular Weight | 514.98 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-[[4-[[4-(3-chloroanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]-(3-methoxyanilino)methyl]formamide |
| SMILES | COc1cccc(NC(NC=O)c2ccc(Nc3[nH]nc4ncnc(Nc5cccc(Cl)c5)c34)cc2)c1 |
| InChI | InChI=1S/C26H23ClN8O2/c1-37-21-7-3-6-20(13-21)32-23(30-15-36)16-8-10-18(11-9-16)31-26-22-24(28-14-29-25(22)34-35-26)33-19-5-2-4-17(27)12-19/h2-15,23,32H,1H3,(H,30,36)(H3,28,29,31,33,34,35) |
| InChIKey | RKGDGSWECKSYFL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.98 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|