C17H16ClN5O — CID 57071330
N-[4-[[[4-(3-chloroanilino)-1H-pyrazol-5-yl]amino]methyl]phenyl]formamide (PubChem CID 57071330) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is N-[4-[[[4-(3-chloroanilino)-1H-pyrazol-5-yl]amino]methyl]phenyl]formamide.
| Compound Name | N-[4-[[[4-(3-chloroanilino)-1H-pyrazol-5-yl]amino]methyl]phenyl]formamide |
|---|---|
| PubChem CID | 57071330 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[4-[[[4-(3-chloroanilino)-1H-pyrazol-5-yl]amino]methyl]phenyl]formamide |
| SMILES | O=CNc1ccc(CNc2[nH]ncc2Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H16ClN5O/c18-13-2-1-3-15(8-13)22-16-10-21-23-17(16)19-9-12-4-6-14(7-5-12)20-11-24/h1-8,10-11,22H,9H2,(H,20,24)(H2,19,21,23) |
| InChIKey | OKOFBZHIYYAUOM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|