C12H15ClN6O — CID 57098049
2-[[4-(3-chloroanilino)-1H-pyrazol-5-yl]amino]ethylurea (PubChem CID 57098049) has the molecular formula C12H15ClN6O and a molecular weight of 294.75 g/mol. Its IUPAC name is 2-[[4-(3-chloroanilino)-1H-pyrazol-5-yl]amino]ethylurea.
| Compound Name | 2-[[4-(3-chloroanilino)-1H-pyrazol-5-yl]amino]ethylurea |
|---|---|
| PubChem CID | 57098049 |
| Molecular Formula | C12H15ClN6O |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[[4-(3-chloroanilino)-1H-pyrazol-5-yl]amino]ethylurea |
| SMILES | NC(=O)NCCNc1[nH]ncc1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H15ClN6O/c13-8-2-1-3-9(6-8)18-10-7-17-19-11(10)15-4-5-16-12(14)20/h1-3,6-7,18H,4-5H2,(H3,14,16,20)(H2,15,17,19) |
| InChIKey | CIQCHRYDOMHSST-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|