C6H4Br2N2O3 — CID 102461642
5-(2,2-dibromoacetyl)-1H-pyrimidine-2,4-dione (PubChem CID 102461642) has the molecular formula C6H4Br2N2O3 and a molecular weight of 311.92 g/mol. Its IUPAC name is 5-(2,2-dibromoacetyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2,2-dibromoacetyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102461642 |
| Molecular Formula | C6H4Br2N2O3 |
| Molecular Weight | 311.92 g/mol |
| Exact Mass | 309.86 |
| IUPAC Name | 5-(2,2-dibromoacetyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1c[nH]c(=O)[nH]c1=O)C(Br)Br |
| InChI | InChI=1S/C6H4Br2N2O3/c7-4(8)3(11)2-1-9-6(13)10-5(2)12/h1,4H,(H2,9,10,12,13) |
| InChIKey | MKBWHXYDEUFHND-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.92 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|