C13H12N4O7S — CID 25047160
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2,4-dioxo-1H-pyrimidine-5-carboxylate (PubChem CID 25047160) has the molecular formula C13H12N4O7S and a molecular weight of 368.33 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2,4-dioxo-1H-pyrimidine-5-carboxylate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2,4-dioxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 25047160 |
| Molecular Formula | C13H12N4O7S |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2,4-dioxo-1H-pyrimidine-5-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)c2c[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C13H12N4O7S/c14-25(22,23)8-3-1-7(2-4-8)16-10(18)6-24-12(20)9-5-15-13(21)17-11(9)19/h1-5H,6H2,(H,16,18)(H2,14,22,23)(H2,15,17,19,21) |
| InChIKey | LWCCWJXGYSXHBW-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 181.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |