C10H16BNO3 — CID 144500695
N,N-dimethylmethanamine;(4-formylphenyl)boronic acid (PubChem CID 144500695) has the molecular formula C10H16BNO3 and a molecular weight of 209.05 g/mol. Its IUPAC name is N,N-dimethylmethanamine;(4-formylphenyl)boronic acid.
| Compound Name | N,N-dimethylmethanamine;(4-formylphenyl)boronic acid |
|---|---|
| PubChem CID | 144500695 |
| Molecular Formula | C10H16BNO3 |
| Molecular Weight | 209.05 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N,N-dimethylmethanamine;(4-formylphenyl)boronic acid |
| SMILES | CN(C)C.O=Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C7H7BO3.C3H9N/c9-5-6-1-3-7(4-2-6)8(10)11;1-4(2)3/h1-5,10-11H;1-3H3 |
| InChIKey | GZKUVBOTDNEUAL-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.05 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|