C31H33BO4 — CID 159864555
4-(2,5-dimethylphenyl)benzaldehyde;(4-formylphenyl)boronic acid;1,2,4-trimethylbenzene (PubChem CID 159864555) has the molecular formula C31H33BO4 and a molecular weight of 480.41 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)benzaldehyde;(4-formylphenyl)boronic acid;1,2,4-trimethylbenzene.
| Compound Name | 4-(2,5-dimethylphenyl)benzaldehyde;(4-formylphenyl)boronic acid;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 159864555 |
| Molecular Formula | C31H33BO4 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 4-(2,5-dimethylphenyl)benzaldehyde;(4-formylphenyl)boronic acid;1,2,4-trimethylbenzene |
| SMILES | Cc1ccc(C)c(-c2ccc(C=O)cc2)c1.Cc1ccc(C)c(C)c1.O=Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C15H14O.C9H12.C7H7BO3/c1-11-3-4-12(2)15(9-11)14-7-5-13(10-16)6-8-14;1-7-4-5-8(2)9(3)6-7;9-5-6-1-3-7(4-2-6)8(10)11/h3-10H,1-2H3;4-6H,1-3H3;1-5,10-11H |
| InChIKey | NROKFXXHLZEKCW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|