C15H13FO — CID 61033101
3-(2,5-dimethylphenyl)-4-fluorobenzaldehyde (PubChem CID 61033101) has the molecular formula C15H13FO and a molecular weight of 228.27 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-4-fluorobenzaldehyde.
| Compound Name | 3-(2,5-dimethylphenyl)-4-fluorobenzaldehyde |
|---|---|
| PubChem CID | 61033101 |
| Molecular Formula | C15H13FO |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-4-fluorobenzaldehyde |
| SMILES | Cc1ccc(C)c(-c2cc(C=O)ccc2F)c1 |
| InChI | InChI=1S/C15H13FO/c1-10-3-4-11(2)13(7-10)14-8-12(9-17)5-6-15(14)16/h3-9H,1-2H3 |
| InChIKey | XNMFFAWBODJLEN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|