C20H18BNO2 — CID 153327063
[4-(3,6-dimethyl-9H-carbazol-1-yl)phenyl]boronic acid (PubChem CID 153327063) has the molecular formula C20H18BNO2 and a molecular weight of 315.18 g/mol. Its IUPAC name is [4-(3,6-dimethyl-9H-carbazol-1-yl)phenyl]boronic acid.
| Compound Name | [4-(3,6-dimethyl-9H-carbazol-1-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 153327063 |
| Molecular Formula | C20H18BNO2 |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | [4-(3,6-dimethyl-9H-carbazol-1-yl)phenyl]boronic acid |
| SMILES | Cc1ccc2[nH]c3c(-c4ccc(B(O)O)cc4)cc(C)cc3c2c1 |
| InChI | InChI=1S/C20H18BNO2/c1-12-3-8-19-17(9-12)18-11-13(2)10-16(20(18)22-19)14-4-6-15(7-5-14)21(23)24/h3-11,22-24H,1-2H3 |
| InChIKey | MCVRTNGCOQJIGH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|