C29H28N2 — CID 174882577
N-[4-(3,6-dimethyl-9H-carbazol-1-yl)phenyl]-2,4,6-trimethylaniline (PubChem CID 174882577) has the molecular formula C29H28N2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-[4-(3,6-dimethyl-9H-carbazol-1-yl)phenyl]-2,4,6-trimethylaniline.
| Compound Name | N-[4-(3,6-dimethyl-9H-carbazol-1-yl)phenyl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 174882577 |
| Molecular Formula | C29H28N2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-[4-(3,6-dimethyl-9H-carbazol-1-yl)phenyl]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(Nc2ccc(-c3cc(C)cc4c3[nH]c3ccc(C)cc34)cc2)c(C)c1 |
| InChI | InChI=1S/C29H28N2/c1-17-6-11-27-25(14-17)26-16-19(3)15-24(29(26)31-27)22-7-9-23(10-8-22)30-28-20(4)12-18(2)13-21(28)5/h6-16,30-31H,1-5H3 |
| InChIKey | GRFAHCBMGNKNGI-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |