C17H16O2 — CID 175324399
5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde (PubChem CID 175324399) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde.
| Compound Name | 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde |
|---|---|
| PubChem CID | 175324399 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde |
| SMILES | Cc1c(C=O)cc(-c2ccc(C=O)cc2)c(C)c1C |
| InChI | InChI=1S/C17H16O2/c1-11-12(2)16(10-19)8-17(13(11)3)15-6-4-14(9-18)5-7-15/h4-10H,1-3H3 |
| InChIKey | KKGGEFNUJJULFU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|