About 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde
5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde (PubChem CID 175324399) has the molecular formula C17H16O2
and a molecular weight of 252.31 g/mol. Its IUPAC name is 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde.
Molecular Properties
| Compound Name | 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde |
| PubChem CID | 175324399 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde |
| SMILES | Cc1c(C=O)cc(-c2ccc(C=O)cc2)c(C)c1C |
| InChI | InChI=1S/C17H16O2/c1-11-12(2)16(10-19)8-17(13(11)3)15-6-4-14(9-18)5-7-15/h4-10H,1-3H3 |
| InChIKey | KKGGEFNUJJULFU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde?
The IUPAC name of 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde (CID 175324399) is 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde.
What is the SMILES notation for 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde?
The canonical SMILES for 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde is Cc1c(C=O)cc(-c2ccc(C=O)cc2)c(C)c1C.
What is the InChIKey of 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde?
The InChIKey is KKGGEFNUJJULFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O2/c1-11-12(2)16(10-19)8-17(13(11)3)15-6-4-14(9-18)5-7-15/h4-10H,1-3H3.
What are the key properties of 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde?
5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde has a molecular weight of 252.31 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-formylphenyl)-2,3,4-trimethylbenzaldehyde is sourced from PubChem (CID 175324399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).