About (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine
(4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine (PubChem CID 87717445) has the molecular formula C18H21BINO5S
and a molecular weight of 501.15 g/mol. Its IUPAC name is (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine.
Molecular Properties
| Compound Name | (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine |
| PubChem CID | 87717445 |
| Molecular Formula | C18H21BINO5S |
| Molecular Weight | 501.15 g/mol |
| Exact Mass | 501.03 |
| IUPAC Name | (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine |
| SMILES | O=Cc1ccc(B(O)O)cc1.O=S(=O)(c1ccc(I)cc1)N1CCCCC1 |
| InChI | InChI=1S/C11H14INO2S.C7H7BO3/c12-10-4-6-11(7-5-10)16(14,15)13-8-2-1-3-9-13;9-5-6-1-3-7(4-2-6)8(10)11/h4-7H,1-3,8-9H2;1-5,10-11H |
| InChIKey | ILTLKFOOBLHWDF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine?
The IUPAC name of (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine (CID 87717445) is (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine.
What is the SMILES notation for (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine?
The canonical SMILES for (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine is O=Cc1ccc(B(O)O)cc1.O=S(=O)(c1ccc(I)cc1)N1CCCCC1.
What is the InChIKey of (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine?
The InChIKey is ILTLKFOOBLHWDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14INO2S.C7H7BO3/c12-10-4-6-11(7-5-10)16(14,15)13-8-2-1-3-9-13;9-5-6-1-3-7(4-2-6)8(10)11/h4-7H,1-3,8-9H2;1-5,10-11H.
What are the key properties of (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine?
(4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine has a molecular weight of 501.15 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formylphenyl)boronic acid;1-(4-iodophenyl)sulfonylpiperidine is sourced from PubChem (CID 87717445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).