C14H23BN2O4S — CID 75486095
[4-[4-(2-methylpropyl)piperazin-1-yl]sulfonylphenyl]boronic acid (PubChem CID 75486095) has the molecular formula C14H23BN2O4S and a molecular weight of 326.23 g/mol. Its IUPAC name is [4-[4-(2-methylpropyl)piperazin-1-yl]sulfonylphenyl]boronic acid.
| Compound Name | [4-[4-(2-methylpropyl)piperazin-1-yl]sulfonylphenyl]boronic acid |
|---|---|
| PubChem CID | 75486095 |
| Molecular Formula | C14H23BN2O4S |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [4-[4-(2-methylpropyl)piperazin-1-yl]sulfonylphenyl]boronic acid |
| SMILES | CC(C)CN1CCN(S(=O)(=O)c2ccc(B(O)O)cc2)CC1 |
| InChI | InChI=1S/C14H23BN2O4S/c1-12(2)11-16-7-9-17(10-8-16)22(20,21)14-5-3-13(4-6-14)15(18)19/h3-6,12,18-19H,7-11H2,1-2H3 |
| InChIKey | MOQLIJGQAFORHG-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|