About (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid
(4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid (PubChem CID 158856473) has the molecular formula C21H23B3O8
and a molecular weight of 435.84 g/mol. Its IUPAC name is (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid.
Molecular Properties
| Compound Name | (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid |
| PubChem CID | 158856473 |
| Molecular Formula | C21H23B3O8 |
| Molecular Weight | 435.84 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid |
| SMILES | COB(O)c1ccc(C=O)cc1.O=Cc1ccc(B(O)O)cc1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C8H9BO3.C7H7BO3.C6H7BO2/c1-12-9(11)8-4-2-7(6-10)3-5-8;9-5-6-1-3-7(4-2-6)8(10)11;8-7(9)6-4-2-1-3-5-6/h2-6,11H,1H3;1-5,10-11H;1-5,8-9H |
| InChIKey | JACQMWVZLSNHCG-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.84 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid?
The IUPAC name of (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid (CID 158856473) is (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid.
What is the SMILES notation for (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid?
The canonical SMILES for (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid is COB(O)c1ccc(C=O)cc1.O=Cc1ccc(B(O)O)cc1.OB(O)c1ccccc1.
What is the InChIKey of (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid?
The InChIKey is JACQMWVZLSNHCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BO3.C7H7BO3.C6H7BO2/c1-12-9(11)8-4-2-7(6-10)3-5-8;9-5-6-1-3-7(4-2-6)8(10)11;8-7(9)6-4-2-1-3-5-6/h2-6,11H,1H3;1-5,10-11H;1-5,8-9H.
What are the key properties of (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid?
(4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid has a molecular weight of 435.84 g/mol, XLogP of -1.62, 6 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formylphenyl)boronic acid;(4-formylphenyl)-methoxyborinic acid;phenylboronic acid is sourced from PubChem (CID 158856473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).