C15H17NO — CID 140581530
1-(2-isocyanatopropan-2-yl)-3-(3-methylbuta-1,3-dienyl)benzene (PubChem CID 140581530) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-(2-isocyanatopropan-2-yl)-3-(3-methylbuta-1,3-dienyl)benzene.
| Compound Name | 1-(2-isocyanatopropan-2-yl)-3-(3-methylbuta-1,3-dienyl)benzene |
|---|---|
| PubChem CID | 140581530 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-(2-isocyanatopropan-2-yl)-3-(3-methylbuta-1,3-dienyl)benzene |
| SMILES | C=C(C)C=Cc1cccc(C(C)(C)N=C=O)c1 |
| InChI | InChI=1S/C15H17NO/c1-12(2)8-9-13-6-5-7-14(10-13)15(3,4)16-11-17/h5-10H,1H2,2-4H3 |
| InChIKey | ZTAQHXAGGWOQQJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|