C13H16INO — CID 89151196
1-(2-iodopropan-2-yl)-3-(2-isocyanatopropan-2-yl)benzene (PubChem CID 89151196) has the molecular formula C13H16INO and a molecular weight of 329.18 g/mol. Its IUPAC name is 1-(2-iodopropan-2-yl)-3-(2-isocyanatopropan-2-yl)benzene.
| Compound Name | 1-(2-iodopropan-2-yl)-3-(2-isocyanatopropan-2-yl)benzene |
|---|---|
| PubChem CID | 89151196 |
| Molecular Formula | C13H16INO |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 1-(2-iodopropan-2-yl)-3-(2-isocyanatopropan-2-yl)benzene |
| SMILES | CC(C)(I)c1cccc(C(C)(C)N=C=O)c1 |
| InChI | InChI=1S/C13H16INO/c1-12(2,14)10-6-5-7-11(8-10)13(3,4)15-9-16/h5-8H,1-4H3 |
| InChIKey | FHIYLVAHULVWNL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|