C20H28N2O — CID 58922218
4-[3-(2-isocyanatopropan-2-yl)phenyl]-4-methyl-2-propylhexanenitrile (PubChem CID 58922218) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 4-[3-(2-isocyanatopropan-2-yl)phenyl]-4-methyl-2-propylhexanenitrile.
| Compound Name | 4-[3-(2-isocyanatopropan-2-yl)phenyl]-4-methyl-2-propylhexanenitrile |
|---|---|
| PubChem CID | 58922218 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 4-[3-(2-isocyanatopropan-2-yl)phenyl]-4-methyl-2-propylhexanenitrile |
| SMILES | CCCC(C#N)CC(C)(CC)c1cccc(C(C)(C)N=C=O)c1 |
| InChI | InChI=1S/C20H28N2O/c1-6-9-16(14-21)13-20(5,7-2)18-11-8-10-17(12-18)19(3,4)22-15-23/h8,10-12,16H,6-7,9,13H2,1-5H3 |
| InChIKey | OPVXBKJHGHJTOG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|